C25H31F3N6O2 — CID 87440882
[4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethylidene]amino]-1-adamantyl] acetate (PubChem CID 87440882) has the molecular formula C25H31F3N6O2 and a molecular weight of 504.56 g/mol. Its IUPAC name is [4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethylidene]amino]-1-adamantyl] acetate.
| Compound Name | [4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethylidene]amino]-1-adamantyl] acetate |
|---|---|
| PubChem CID | 87440882 |
| Molecular Formula | C25H31F3N6O2 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | [4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethylidene]amino]-1-adamantyl] acetate |
| SMILES | CC(=O)OC12CC3CC(C1)C(/N=C(/CN1CCN(c4ccc(C(F)(F)F)cn4)CC1)NC#N)C(C3)C2 |
| InChI | InChI=1S/C25H31F3N6O2/c1-16(35)36-24-10-17-8-18(11-24)23(19(9-17)12-24)32-21(31-15-29)14-33-4-6-34(7-5-33)22-3-2-20(13-30-22)25(26,27)28/h2-3,13,17-19,23H,4-12,14H2,1H3,(H,31,32) |
| InChIKey | JVWGIIVETGUTHQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 93.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|