C26H34F3N7O — CID 87441422
N-[4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propylidene]amino]-1-adamantyl]acetamide (PubChem CID 87441422) has the molecular formula C26H34F3N7O and a molecular weight of 517.60 g/mol. Its IUPAC name is N-[4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propylidene]amino]-1-adamantyl]acetamide.
| Compound Name | N-[4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propylidene]amino]-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 87441422 |
| Molecular Formula | C26H34F3N7O |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | N-[4-[[1-(cyanoamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propylidene]amino]-1-adamantyl]acetamide |
| SMILES | CC(=O)NC12CC3CC(C1)C(/N=C(\NC#N)C(C)N1CCN(c4ccc(C(F)(F)F)cn4)CC1)C(C3)C2 |
| InChI | InChI=1S/C26H34F3N7O/c1-16(35-5-7-36(8-6-35)22-4-3-21(14-31-22)26(27,28)29)24(32-15-30)33-23-19-9-18-10-20(23)13-25(11-18,12-19)34-17(2)37/h3-4,14,16,18-20,23H,5-13H2,1-2H3,(H,32,33)(H,34,37) |
| InChIKey | BQFNSKNOPVUUAH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|