C25H33F3N6 — CID 87440876
N-cyano-N'-(5-deuterio-2-adamantyl)-2-methyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanimidamide (PubChem CID 87440876) has the molecular formula C25H33F3N6 and a molecular weight of 475.58 g/mol. Its IUPAC name is N-cyano-N'-(5-deuterio-2-adamantyl)-2-methyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanimidamide.
| Compound Name | N-cyano-N'-(5-deuterio-2-adamantyl)-2-methyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanimidamide |
|---|---|
| PubChem CID | 87440876 |
| Molecular Formula | C25H33F3N6 |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | N-cyano-N'-(5-deuterio-2-adamantyl)-2-methyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanimidamide |
| SMILES | [2H]C12CC3CC(C1)C(/N=C(\NC#N)C(C)(C)N1CCN(c4ccc(C(F)(F)F)cn4)CC1)C(C3)C2 |
| InChI | InChI=1S/C25H33F3N6/c1-24(2,23(31-15-29)32-22-18-10-16-9-17(12-18)13-19(22)11-16)34-7-5-33(6-8-34)21-4-3-20(14-30-21)25(26,27)28/h3-4,14,16-19,22H,5-13H2,1-2H3,(H,31,32)/i16D |
| InChIKey | PCJJHLFVFIBMAY-QNLPYAOMSA-N |
| XLogP | 4.29 |
| TPSA | 67.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|