C26H34N6O4 — CID 87441482
4-[[1-(cyanoamino)-2-methyl-2-[4-(4-nitrophenyl)piperazin-1-yl]propylidene]amino]adamantane-1-carboxylic acid (PubChem CID 87441482) has the molecular formula C26H34N6O4 and a molecular weight of 494.60 g/mol. Its IUPAC name is 4-[[1-(cyanoamino)-2-methyl-2-[4-(4-nitrophenyl)piperazin-1-yl]propylidene]amino]adamantane-1-carboxylic acid.
| Compound Name | 4-[[1-(cyanoamino)-2-methyl-2-[4-(4-nitrophenyl)piperazin-1-yl]propylidene]amino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 87441482 |
| Molecular Formula | C26H34N6O4 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 4-[[1-(cyanoamino)-2-methyl-2-[4-(4-nitrophenyl)piperazin-1-yl]propylidene]amino]adamantane-1-carboxylic acid |
| SMILES | CC(C)(/C(=N/C1C2CC3CC1CC(C(=O)O)(C3)C2)NC#N)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C26H34N6O4/c1-25(2,31-9-7-30(8-10-31)20-3-5-21(6-4-20)32(35)36)23(28-16-27)29-22-18-11-17-12-19(22)15-26(13-17,14-18)24(33)34/h3-6,17-19,22H,7-15H2,1-2H3,(H,28,29)(H,33,34) |
| InChIKey | BHCPBZZJXVNEJF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|