C24H32F3N7 — CID 87440775
N-(1-azatricyclo[3.3.1.13,7]decan-4-yl)-N-cyano-2-methyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanimidamide (PubChem CID 87440775) has the molecular formula C24H32F3N7 and a molecular weight of 475.56 g/mol. Its IUPAC name is N-(1-azatricyclo[3.3.1.13,7]decan-4-yl)-N-cyano-2-methyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanimidamide.
| Compound Name | N-(1-azatricyclo[3.3.1.13,7]decan-4-yl)-N-cyano-2-methyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanimidamide |
|---|---|
| PubChem CID | 87440775 |
| Molecular Formula | C24H32F3N7 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | N-(1-azatricyclo[3.3.1.13,7]decan-4-yl)-N-cyano-2-methyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanimidamide |
| SMILES | [H]/N=C(/N(C#N)C1C2CC3CC1CN(C3)C2)C(C)(C)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C24H32F3N7/c1-23(2,22(29)34(15-28)21-17-9-16-10-18(21)14-31(12-16)13-17)33-7-5-32(6-8-33)20-4-3-19(11-30-20)24(25,26)27/h3-4,11,16-18,21,29H,5-10,12-14H2,1-2H3/b29-22+ |
| InChIKey | CXHOREFYTXXBAG-QUPMIFSKSA-N |
| XLogP | 3.10 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|