C23H29FN4O2 — CID 87440713
4-[[1-(cyanoamino)-2-[(3-fluorophenyl)methoxy]-2-methylpropylidene]amino]adamantane-1-carboxamide (PubChem CID 87440713) has the molecular formula C23H29FN4O2 and a molecular weight of 412.51 g/mol. Its IUPAC name is 4-[[1-(cyanoamino)-2-[(3-fluorophenyl)methoxy]-2-methylpropylidene]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[1-(cyanoamino)-2-[(3-fluorophenyl)methoxy]-2-methylpropylidene]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 87440713 |
| Molecular Formula | C23H29FN4O2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 4-[[1-(cyanoamino)-2-[(3-fluorophenyl)methoxy]-2-methylpropylidene]amino]adamantane-1-carboxamide |
| SMILES | CC(C)(OCc1cccc(F)c1)/C(=N/C1C2CC3CC1CC(C(N)=O)(C3)C2)NC#N |
| InChI | InChI=1S/C23H29FN4O2/c1-22(2,30-12-14-4-3-5-18(24)8-14)21(27-13-25)28-19-16-6-15-7-17(19)11-23(9-15,10-16)20(26)29/h3-5,8,15-17,19H,6-7,9-12H2,1-2H3,(H2,26,29)(H,27,28) |
| InChIKey | SNCZCRNRTNHUPI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|