C22H30N2O3 — CID 66628595
4-[[2-methyl-2-(N-methylanilino)propanoyl]amino]adamantane-1-carboxylic acid (PubChem CID 66628595) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 4-[[2-methyl-2-(N-methylanilino)propanoyl]amino]adamantane-1-carboxylic acid.
| Compound Name | 4-[[2-methyl-2-(N-methylanilino)propanoyl]amino]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 66628595 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 4-[[2-methyl-2-(N-methylanilino)propanoyl]amino]adamantane-1-carboxylic acid |
| SMILES | CN(c1ccccc1)C(C)(C)C(=O)NC1C2CC3CC1CC(C(=O)O)(C3)C2 |
| InChI | InChI=1S/C22H30N2O3/c1-21(2,24(3)17-7-5-4-6-8-17)19(25)23-18-15-9-14-10-16(18)13-22(11-14,12-15)20(26)27/h4-8,14-16,18H,9-13H2,1-3H3,(H,23,25)(H,26,27) |
| InChIKey | ZYTDMPVFNVPAFE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |