C15H21NO4S — CID 43361662
2-cyclopropyl-2-[(4-propylphenyl)sulfonylamino]propanoic acid (PubChem CID 43361662) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(4-propylphenyl)sulfonylamino]propanoic acid.
| Compound Name | 2-cyclopropyl-2-[(4-propylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 43361662 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-cyclopropyl-2-[(4-propylphenyl)sulfonylamino]propanoic acid |
| SMILES | CCCc1ccc(S(=O)(=O)NC(C)(C(=O)O)C2CC2)cc1 |
| InChI | InChI=1S/C15H21NO4S/c1-3-4-11-5-9-13(10-6-11)21(19,20)16-15(2,14(17)18)12-7-8-12/h5-6,9-10,12,16H,3-4,7-8H2,1-2H3,(H,17,18) |
| InChIKey | PBGOFOCJRBXFLN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |