C19H26N2O4S2 — CID 17380992
N-[4-(tert-butylsulfamoyl)phenyl]-4-propylbenzenesulfonamide (PubChem CID 17380992) has the molecular formula C19H26N2O4S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[4-(tert-butylsulfamoyl)phenyl]-4-propylbenzenesulfonamide.
| Compound Name | N-[4-(tert-butylsulfamoyl)phenyl]-4-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 17380992 |
| Molecular Formula | C19H26N2O4S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[4-(tert-butylsulfamoyl)phenyl]-4-propylbenzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)NC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H26N2O4S2/c1-5-6-15-7-11-17(12-8-15)26(22,23)20-16-9-13-18(14-10-16)27(24,25)21-19(2,3)4/h7-14,20-21H,5-6H2,1-4H3 |
| InChIKey | ZKVDLVPNACSEIL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |