About N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen
N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen (PubChem CID 177246502) has the molecular formula C16H24N2O4S2
and a molecular weight of 372.51 g/mol. Its IUPAC name is N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen.
Molecular Properties
| Compound Name | N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen |
| PubChem CID | 177246502 |
| Molecular Formula | C16H24N2O4S2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen |
| SMILES | CCCc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)NC)cc2)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C16H20N2O4S2.2H2/c1-3-4-13-5-9-16(10-6-13)24(21,22)18-14-7-11-15(12-8-14)23(19,20)17-2;;/h5-12,17-18H,3-4H2,1-2H3;2*1H |
| InChIKey | LHTSDIXUPZJFIQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen?
The IUPAC name of N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen (CID 177246502) is N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen.
What is the SMILES notation for N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen?
The canonical SMILES for N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen is CCCc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)NC)cc2)cc1.[H][H].[H][H].
What is the InChIKey of N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen?
The InChIKey is LHTSDIXUPZJFIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O4S2.2H2/c1-3-4-13-5-9-16(10-6-13)24(21,22)18-14-7-11-15(12-8-14)23(19,20)17-2;;/h5-12,17-18H,3-4H2,1-2H3;2*1H.
What are the key properties of N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen?
N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen has a molecular weight of 372.51 g/mol, XLogP of 2.84, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(methylsulfamoyl)phenyl]-4-propylbenzenesulfonamide;molecular hydrogen is sourced from PubChem (CID 177246502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).