About 2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride
2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride (PubChem CID 70525718) has the molecular formula C12H23ClN2
and a molecular weight of 230.78 g/mol. Its IUPAC name is 2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride |
| PubChem CID | 70525718 |
| Molecular Formula | C12H23ClN2 |
| Molecular Weight | 230.78 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride |
| SMILES | CN(C)NC12CC3CC(CC(C3)C1)C2.Cl |
| InChI | InChI=1S/C12H22N2.ClH/c1-14(2)13-12-6-9-3-10(7-12)5-11(4-9)8-12;/h9-11,13H,3-8H2,1-2H3;1H |
| InChIKey | NNKSHBCDVYHPQT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.78 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride?
The IUPAC name of 2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride (CID 70525718) is 2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride.
What is the SMILES notation for 2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride?
The canonical SMILES for 2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride is CN(C)NC12CC3CC(CC(C3)C1)C2.Cl.
What is the InChIKey of 2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride?
The InChIKey is NNKSHBCDVYHPQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2.ClH/c1-14(2)13-12-6-9-3-10(7-12)5-11(4-9)8-12;/h9-11,13H,3-8H2,1-2H3;1H.
What are the key properties of 2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride?
2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride has a molecular weight of 230.78 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-1,1-dimethylhydrazine;hydrochloride is sourced from PubChem (CID 70525718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).