C19H28 — CID 162754707
1-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-3,3,7-trimethylbicyclo[3.3.1]nonane (PubChem CID 162754707) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is 1-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-3,3,7-trimethylbicyclo[3.3.1]nonane.
| Compound Name | 1-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-3,3,7-trimethylbicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 162754707 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-3,3,7-trimethylbicyclo[3.3.1]nonane |
| SMILES | C#C/C=C\C(=C/C)C12CC(C)CC(CC(C)(C)C1)C2 |
| InChI | InChI=1S/C19H28/c1-6-8-9-17(7-2)19-11-15(3)10-16(13-19)12-18(4,5)14-19/h1,7-9,15-16H,10-14H2,2-5H3/b9-8-,17-7+ |
| InChIKey | OXHILQPIRIEMIF-XREYBLJHSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|