C11H22N2 — CID 170605950
3,7-dimethylbicyclo[3.3.1]nonane-1,3-diamine (PubChem CID 170605950) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 3,7-dimethylbicyclo[3.3.1]nonane-1,3-diamine.
| Compound Name | 3,7-dimethylbicyclo[3.3.1]nonane-1,3-diamine |
|---|---|
| PubChem CID | 170605950 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 3,7-dimethylbicyclo[3.3.1]nonane-1,3-diamine |
| SMILES | CC1CC2CC(C)(N)CC(N)(C1)C2 |
| InChI | InChI=1S/C11H22N2/c1-8-3-9-5-10(2,12)7-11(13,4-8)6-9/h8-9H,3-7,12-13H2,1-2H3 |
| InChIKey | WDXUCEPTXUSLJW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |