C11H21NO — CID 123493909
7-amino-3,7-dimethylbicyclo[3.3.1]nonan-3-ol (PubChem CID 123493909) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 7-amino-3,7-dimethylbicyclo[3.3.1]nonan-3-ol.
| Compound Name | 7-amino-3,7-dimethylbicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 123493909 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 7-amino-3,7-dimethylbicyclo[3.3.1]nonan-3-ol |
| SMILES | CC1(N)CC2CC(C1)CC(C)(O)C2 |
| InChI | InChI=1S/C11H21NO/c1-10(12)4-8-3-9(5-10)7-11(2,13)6-8/h8-9,13H,3-7,12H2,1-2H3 |
| InChIKey | KXARJBYOKXOVGK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |