C12H20O2 — CID 141116572
2,2-dimethyladamantane-1,3-diol (PubChem CID 141116572) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 2,2-dimethyladamantane-1,3-diol.
| Compound Name | 2,2-dimethyladamantane-1,3-diol |
|---|---|
| PubChem CID | 141116572 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2,2-dimethyladamantane-1,3-diol |
| SMILES | CC1(C)C2(O)CC3CC(C2)CC1(O)C3 |
| InChI | InChI=1S/C12H20O2/c1-10(2)11(13)4-8-3-9(6-11)7-12(10,14)5-8/h8-9,13-14H,3-7H2,1-2H3 |
| InChIKey | JEBICTWZWXZTNT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |