About [7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol
[7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol (PubChem CID 139437917) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is [7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol.
Molecular Properties
| Compound Name | [7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol |
| PubChem CID | 139437917 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | [7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol |
| SMILES | CC1(CO)CC2CC(C1)CC(C)(CO)C2 |
| InChI | InChI=1S/C13H24O2/c1-12(8-14)4-10-3-11(5-12)7-13(2,6-10)9-15/h10-11,14-15H,3-9H2,1-2H3 |
| InChIKey | GGBIKKZRTDSTJZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol?
The IUPAC name of [7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol (CID 139437917) is [7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol.
What is the SMILES notation for [7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol?
The canonical SMILES for [7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol is CC1(CO)CC2CC(C1)CC(C)(CO)C2.
What is the InChIKey of [7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol?
The InChIKey is GGBIKKZRTDSTJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-12(8-14)4-10-3-11(5-12)7-13(2,6-10)9-15/h10-11,14-15H,3-9H2,1-2H3.
What are the key properties of [7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol?
[7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol has a molecular weight of 212.33 g/mol, XLogP of 2.19, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(hydroxymethyl)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]methanol is sourced from PubChem (CID 139437917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).