C11H18O — CID 135037653
(4S)-4-methyltricyclo[4.3.1.03,8]decan-4-ol (PubChem CID 135037653) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (4S)-4-methyltricyclo[4.3.1.03,8]decan-4-ol.
| Compound Name | (4S)-4-methyltricyclo[4.3.1.03,8]decan-4-ol |
|---|---|
| PubChem CID | 135037653 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (4S)-4-methyltricyclo[4.3.1.03,8]decan-4-ol |
| SMILES | C[C@]1(O)CC2CC3CC(C2)C1C3 |
| InChI | InChI=1S/C11H18O/c1-11(12)6-8-2-7-3-9(4-8)10(11)5-7/h7-10,12H,2-6H2,1H3/t7?,8?,9?,10?,11-/m0/s1 |
| InChIKey | VOYQTYYXHMZMAT-FIJQTJJSSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |