About tricyclo[4.2.1.03,7]nonan-3-ol
tricyclo[4.2.1.03,7]nonan-3-ol (PubChem CID 4163021) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is tricyclo[4.2.1.03,7]nonan-3-ol.
Molecular Properties
| Compound Name | tricyclo[4.2.1.03,7]nonan-3-ol |
| PubChem CID | 4163021 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | tricyclo[4.2.1.03,7]nonan-3-ol |
| SMILES | OC12CCC3CC(CC31)C2 |
| InChI | InChI=1S/C9H14O/c10-9-2-1-7-3-6(5-9)4-8(7)9/h6-8,10H,1-5H2 |
| InChIKey | VCEPCSVFFOPLEK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tricyclo[4.2.1.03,7]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[4.2.1.03,7]nonan-3-ol?
The IUPAC name of tricyclo[4.2.1.03,7]nonan-3-ol (CID 4163021) is tricyclo[4.2.1.03,7]nonan-3-ol.
What is the SMILES notation for tricyclo[4.2.1.03,7]nonan-3-ol?
The canonical SMILES for tricyclo[4.2.1.03,7]nonan-3-ol is OC12CCC3CC(CC31)C2.
What is the InChIKey of tricyclo[4.2.1.03,7]nonan-3-ol?
The InChIKey is VCEPCSVFFOPLEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O/c10-9-2-1-7-3-6(5-9)4-8(7)9/h6-8,10H,1-5H2.
What are the key properties of tricyclo[4.2.1.03,7]nonan-3-ol?
tricyclo[4.2.1.03,7]nonan-3-ol has a molecular weight of 138.21 g/mol, XLogP of 1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[4.2.1.03,7]nonan-3-ol is sourced from PubChem (CID 4163021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).