C10H15ClO — CID 130909196
(2R,7S)-2-chloroadamantan-1-ol (PubChem CID 130909196) has the molecular formula C10H15ClO and a molecular weight of 186.68 g/mol. Its IUPAC name is (2R,7S)-2-chloroadamantan-1-ol.
| Compound Name | (2R,7S)-2-chloroadamantan-1-ol |
|---|---|
| PubChem CID | 130909196 |
| Molecular Formula | C10H15ClO |
| Molecular Weight | 186.68 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | (2R,7S)-2-chloroadamantan-1-ol |
| SMILES | OC12CC3CC(C[C@H](C3)C1)[C@H]2Cl |
| InChI | InChI=1S/C10H15ClO/c11-9-8-2-6-1-7(3-8)5-10(9,12)4-6/h6-9,12H,1-5H2/t6-,7?,8?,9+,10?/m0/s1 |
| InChIKey | WECORAPXDUOSFU-DZYDGNKRSA-N |
| XLogP | 2.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.68 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|