About 5-chloroadamantan-2-ol
5-chloroadamantan-2-ol (PubChem CID 12660028) has the molecular formula C10H15ClO
and a molecular weight of 186.68 g/mol. Its IUPAC name is 5-chloroadamantan-2-ol.
Molecular Properties
| Compound Name | 5-chloroadamantan-2-ol |
| PubChem CID | 12660028 |
| Molecular Formula | C10H15ClO |
| Molecular Weight | 186.68 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 5-chloroadamantan-2-ol |
| SMILES | OC1C2CC3CC1CC(Cl)(C3)C2 |
| InChI | InChI=1S/C10H15ClO/c11-10-3-6-1-7(4-10)9(12)8(2-6)5-10/h6-9,12H,1-5H2 |
| InChIKey | ZPDSKYXXCIKMJN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.68 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloroadamantan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloroadamantan-2-ol?
The IUPAC name of 5-chloroadamantan-2-ol (CID 12660028) is 5-chloroadamantan-2-ol.
What is the SMILES notation for 5-chloroadamantan-2-ol?
The canonical SMILES for 5-chloroadamantan-2-ol is OC1C2CC3CC1CC(Cl)(C3)C2.
What is the InChIKey of 5-chloroadamantan-2-ol?
The InChIKey is ZPDSKYXXCIKMJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClO/c11-10-3-6-1-7(4-10)9(12)8(2-6)5-10/h6-9,12H,1-5H2.
What are the key properties of 5-chloroadamantan-2-ol?
5-chloroadamantan-2-ol has a molecular weight of 186.68 g/mol, XLogP of 2.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloroadamantan-2-ol is sourced from PubChem (CID 12660028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).