C10H17NO — CID 130835060
(1S,2S,6S,8R)-5-azatricyclo[6.2.1.02,6]undecan-1-ol (PubChem CID 130835060) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (1S,2S,6S,8R)-5-azatricyclo[6.2.1.02,6]undecan-1-ol.
| Compound Name | (1S,2S,6S,8R)-5-azatricyclo[6.2.1.02,6]undecan-1-ol |
|---|---|
| PubChem CID | 130835060 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (1S,2S,6S,8R)-5-azatricyclo[6.2.1.02,6]undecan-1-ol |
| SMILES | O[C@]12CC[C@H](C[C@@H]3NCC[C@@H]31)C2 |
| InChI | InChI=1S/C10H17NO/c12-10-3-1-7(6-10)5-9-8(10)2-4-11-9/h7-9,11-12H,1-6H2/t7-,8+,9+,10+/m1/s1 |
| InChIKey | XCHIEANCWNSEFV-KATARQTJSA-N |
| XLogP | 0.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |