C10H16O2 — CID 130927450
(1S,3S,6S,7R,9R)-tricyclo[4.3.1.03,7]decane-3,9-diol (PubChem CID 130927450) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (1S,3S,6S,7R,9R)-tricyclo[4.3.1.03,7]decane-3,9-diol.
| Compound Name | (1S,3S,6S,7R,9R)-tricyclo[4.3.1.03,7]decane-3,9-diol |
|---|---|
| PubChem CID | 130927450 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (1S,3S,6S,7R,9R)-tricyclo[4.3.1.03,7]decane-3,9-diol |
| SMILES | O[C@@H]1C[C@@H]2[C@H]3CC[C@]2(O)C[C@@H]1C3 |
| InChI | InChI=1S/C10H16O2/c11-9-4-8-6-1-2-10(8,12)5-7(9)3-6/h6-9,11-12H,1-5H2/t6-,7-,8+,9+,10-/m0/s1 |
| InChIKey | MMKYBLGKMVGHON-OEZYJKACSA-N |
| XLogP | 0.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |