About 8-anilinotricyclo[4.2.1.03,7]nonan-3-ol
8-anilinotricyclo[4.2.1.03,7]nonan-3-ol (PubChem CID 564858) has the molecular formula C15H19NO
and a molecular weight of 229.32 g/mol. Its IUPAC name is 8-anilinotricyclo[4.2.1.03,7]nonan-3-ol.
Molecular Properties
| Compound Name | 8-anilinotricyclo[4.2.1.03,7]nonan-3-ol |
| PubChem CID | 564858 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 8-anilinotricyclo[4.2.1.03,7]nonan-3-ol |
| SMILES | OC12CCC3CC(C1)C(Nc1ccccc1)C32 |
| InChI | InChI=1S/C15H19NO/c17-15-7-6-10-8-11(9-15)14(13(10)15)16-12-4-2-1-3-5-12/h1-5,10-11,13-14,16-17H,6-9H2 |
| InChIKey | RGHKHBGVOWIFHN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-anilinotricyclo[4.2.1.03,7]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-anilinotricyclo[4.2.1.03,7]nonan-3-ol?
The IUPAC name of 8-anilinotricyclo[4.2.1.03,7]nonan-3-ol (CID 564858) is 8-anilinotricyclo[4.2.1.03,7]nonan-3-ol.
What is the SMILES notation for 8-anilinotricyclo[4.2.1.03,7]nonan-3-ol?
The canonical SMILES for 8-anilinotricyclo[4.2.1.03,7]nonan-3-ol is OC12CCC3CC(C1)C(Nc1ccccc1)C32.
What is the InChIKey of 8-anilinotricyclo[4.2.1.03,7]nonan-3-ol?
The InChIKey is RGHKHBGVOWIFHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO/c17-15-7-6-10-8-11(9-15)14(13(10)15)16-12-4-2-1-3-5-12/h1-5,10-11,13-14,16-17H,6-9H2.
What are the key properties of 8-anilinotricyclo[4.2.1.03,7]nonan-3-ol?
8-anilinotricyclo[4.2.1.03,7]nonan-3-ol has a molecular weight of 229.32 g/mol, XLogP of 2.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-anilinotricyclo[4.2.1.03,7]nonan-3-ol is sourced from PubChem (CID 564858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).