C9H14O — CID 10011966
(1R,3S,5R,7S)-2-methyltricyclo[5.1.0.03,5]octan-2-ol (PubChem CID 10011966) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (1R,3S,5R,7S)-2-methyltricyclo[5.1.0.03,5]octan-2-ol.
| Compound Name | (1R,3S,5R,7S)-2-methyltricyclo[5.1.0.03,5]octan-2-ol |
|---|---|
| PubChem CID | 10011966 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (1R,3S,5R,7S)-2-methyltricyclo[5.1.0.03,5]octan-2-ol |
| SMILES | CC1(O)[C@@H]2C[C@@H]2C[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C9H14O/c1-9(10)7-3-5(7)2-6-4-8(6)9/h5-8,10H,2-4H2,1H3/t5-,6+,7+,8-,9? |
| InChIKey | IBDRUMVVBXCOGV-ASJMJZICSA-N |
| XLogP | 1.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |