About (4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol
(4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol (PubChem CID 135037655) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is (4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol.
Molecular Properties
| Compound Name | (4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol |
| PubChem CID | 135037655 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol |
| SMILES | OCC#C[C@]1(O)CC2CC3CC(C2)C1C3 |
| InChI | InChI=1S/C13H18O2/c14-3-1-2-13(15)8-10-4-9-5-11(6-10)12(13)7-9/h9-12,14-15H,3-8H2/t9?,10?,11?,12?,13-/m0/s1 |
| InChIKey | KOGSBZZNWDXKMZ-XHFUNPKLSA-N |
| XLogP | 1.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol?
The IUPAC name of (4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol (CID 135037655) is (4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol.
What is the SMILES notation for (4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol?
The canonical SMILES for (4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol is OCC#C[C@]1(O)CC2CC3CC(C2)C1C3.
What is the InChIKey of (4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol?
The InChIKey is KOGSBZZNWDXKMZ-XHFUNPKLSA-N. The full InChI is InChI=1S/C13H18O2/c14-3-1-2-13(15)8-10-4-9-5-11(6-10)12(13)7-9/h9-12,14-15H,3-8H2/t9?,10?,11?,12?,13-/m0/s1.
What are the key properties of (4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol?
(4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol has a molecular weight of 206.28 g/mol, XLogP of 1.17, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(3-hydroxyprop-1-ynyl)tricyclo[4.3.1.03,8]decan-4-ol is sourced from PubChem (CID 135037655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).