About adamantane;1-methyladamantane
adamantane;1-methyladamantane (PubChem CID 53425859) has the molecular formula C21H34
and a molecular weight of 286.50 g/mol. Its IUPAC name is adamantane;1-methyladamantane.
Molecular Properties
| Compound Name | adamantane;1-methyladamantane |
| PubChem CID | 53425859 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | adamantane;1-methyladamantane |
| SMILES | C1C2CC3CC1CC(C2)C3.CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C11H18.C10H16/c1-11-5-8-2-9(6-11)4-10(3-8)7-11;1-7-2-9-4-8(1)5-10(3-7)6-9/h8-10H,2-7H2,1H3;7-10H,1-6H2 |
| InChIKey | QPPOTYRDPGEKDP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze adamantane;1-methyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;1-methyladamantane?
The IUPAC name of adamantane;1-methyladamantane (CID 53425859) is adamantane;1-methyladamantane.
What is the SMILES notation for adamantane;1-methyladamantane?
The canonical SMILES for adamantane;1-methyladamantane is C1C2CC3CC1CC(C2)C3.CC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of adamantane;1-methyladamantane?
The InChIKey is QPPOTYRDPGEKDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18.C10H16/c1-11-5-8-2-9(6-11)4-10(3-8)7-11;1-7-2-9-4-8(1)5-10(3-7)6-9/h8-10H,2-7H2,1H3;7-10H,1-6H2.
What are the key properties of adamantane;1-methyladamantane?
adamantane;1-methyladamantane has a molecular weight of 286.50 g/mol, XLogP of 6.06, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;1-methyladamantane is sourced from PubChem (CID 53425859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).