C12H18 — CID 10034924
(3R,5S)-1-methyl-4-methylideneadamantane (PubChem CID 10034924) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is (3R,5S)-1-methyl-4-methylideneadamantane.
| Compound Name | (3R,5S)-1-methyl-4-methylideneadamantane |
|---|---|
| PubChem CID | 10034924 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (3R,5S)-1-methyl-4-methylideneadamantane |
| SMILES | C=C1[C@@H]2CC3C[C@H]1CC(C)(C3)C2 |
| InChI | InChI=1S/C12H18/c1-8-10-3-9-4-11(8)7-12(2,5-9)6-10/h9-11H,1,3-7H2,2H3/t9?,10-,11+,12? |
| InChIKey | HREPUWCTJGCDDS-WSVSKBAQSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|