C22H32 — CID 101019759
(2E,5R,7S)-1-methyl-2-[(5R,7S)-1-methyl-2-adamantylidene]adamantane (PubChem CID 101019759) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol. Its IUPAC name is (2E,5R,7S)-1-methyl-2-[(5R,7S)-1-methyl-2-adamantylidene]adamantane.
| Compound Name | (2E,5R,7S)-1-methyl-2-[(5R,7S)-1-methyl-2-adamantylidene]adamantane |
|---|---|
| PubChem CID | 101019759 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | (2E,5R,7S)-1-methyl-2-[(5R,7S)-1-methyl-2-adamantylidene]adamantane |
| SMILES | CC12C[C@@H]3CC(C[C@@H](C3)C1)/C2=C1/C2C[C@@H]3C[C@H](C2)CC1(C)C3 |
| InChI | InChI=1S/C22H32/c1-21-9-13-3-14(10-21)6-17(5-13)19(21)20-18-7-15-4-16(8-18)12-22(20,2)11-15/h13-18H,3-12H2,1-2H3/b20-19+/t13-,14+,15-,16+,17?,18?,21?,22? |
| InChIKey | FWVSYUFXTIUZDL-RIRNUEDDSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|