C25H32 — CID 143365139
3,7-dimethyl-3,7-bis(4-methylphenyl)bicyclo[3.3.1]nonane (PubChem CID 143365139) has the molecular formula C25H32 and a molecular weight of 332.53 g/mol. Its IUPAC name is 3,7-dimethyl-3,7-bis(4-methylphenyl)bicyclo[3.3.1]nonane.
| Compound Name | 3,7-dimethyl-3,7-bis(4-methylphenyl)bicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 143365139 |
| Molecular Formula | C25H32 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 3,7-dimethyl-3,7-bis(4-methylphenyl)bicyclo[3.3.1]nonane |
| SMILES | Cc1ccc(C2(C)CC3CC(C2)CC(C)(c2ccc(C)cc2)C3)cc1 |
| InChI | InChI=1S/C25H32/c1-18-5-9-22(10-6-18)24(3)14-20-13-21(15-24)17-25(4,16-20)23-11-7-19(2)8-12-23/h5-12,20-21H,13-17H2,1-4H3 |
| InChIKey | GFUJFVMUJYWGST-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |