C32H38 — CID 143639532
3,7-dimethyl-1,3,7-tris(4-methylphenyl)bicyclo[3.3.1]nonane (PubChem CID 143639532) has the molecular formula C32H38 and a molecular weight of 422.66 g/mol. Its IUPAC name is 3,7-dimethyl-1,3,7-tris(4-methylphenyl)bicyclo[3.3.1]nonane.
| Compound Name | 3,7-dimethyl-1,3,7-tris(4-methylphenyl)bicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 143639532 |
| Molecular Formula | C32H38 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 3,7-dimethyl-1,3,7-tris(4-methylphenyl)bicyclo[3.3.1]nonane |
| SMILES | Cc1ccc(C2(C)CC3CC(C)(c4ccc(C)cc4)CC(c4ccc(C)cc4)(C3)C2)cc1 |
| InChI | InChI=1S/C32H38/c1-23-6-12-27(13-7-23)30(4)18-26-19-31(5,28-14-8-24(2)9-15-28)22-32(20-26,21-30)29-16-10-25(3)11-17-29/h6-17,26H,18-22H2,1-5H3 |
| InChIKey | OUGFGRHWBSNCHS-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |