C24H34 — CID 177433784
(8S,10R,13Z,17S,19R)-heptacyclo[15.3.1.16,10.18,12.115,19.01,14.06,13]tetracos-13-ene (PubChem CID 177433784) has the molecular formula C24H34 and a molecular weight of 322.54 g/mol. Its IUPAC name is (8S,10R,13Z,17S,19R)-heptacyclo[15.3.1.16,10.18,12.115,19.01,14.06,13]tetracos-13-ene.
| Compound Name | (8S,10R,13Z,17S,19R)-heptacyclo[15.3.1.16,10.18,12.115,19.01,14.06,13]tetracos-13-ene |
|---|---|
| PubChem CID | 177433784 |
| Molecular Formula | C24H34 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | (8S,10R,13Z,17S,19R)-heptacyclo[15.3.1.16,10.18,12.115,19.01,14.06,13]tetracos-13-ene |
| SMILES | C1CCC23C[C@@H]4CC(C[C@@H](C4)C2)/C3=C2\C3C[C@@H]4C[C@H](C3)CC2(C1)C4 |
| InChI | InChI=1S/C24H34/c1-2-4-24-13-17-6-18(14-24)10-20(9-17)22(24)21-19-7-15-5-16(8-19)12-23(21,3-1)11-15/h15-20H,1-14H2/b22-21-/t15-,16+,17-,18+,19?,20?,23?,24? |
| InChIKey | BWNPRNOGNCRINL-MHFGSFKMSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|