C22H30P2Se — CID 134912412
2,5-bis(1-adamantyl)-1,3,4-selenadiphosphole (PubChem CID 134912412) has the molecular formula C22H30P2Se and a molecular weight of 435.39 g/mol. Its IUPAC name is 2,5-bis(1-adamantyl)-1,3,4-selenadiphosphole.
| Compound Name | 2,5-bis(1-adamantyl)-1,3,4-selenadiphosphole |
|---|---|
| PubChem CID | 134912412 |
| Molecular Formula | C22H30P2Se |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2,5-bis(1-adamantyl)-1,3,4-selenadiphosphole |
| SMILES | C1C2CC3CC1CC(c1ppc(C45CC6CC(CC(C6)C4)C5)[se]1)(C2)C3 |
| InChI | InChI=1S/C22H30P2Se/c1-13-2-15-3-14(1)8-21(7-13,9-15)19-23-24-20(25-19)22-10-16-4-17(11-22)6-18(5-16)12-22/h13-18H,1-12H2 |
| InChIKey | HAENEWWFFSODID-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|