C38H52O — CID 87124806
2,4,5-tris(1-adamantyl)-3,6-dimethylphenol (PubChem CID 87124806) has the molecular formula C38H52O and a molecular weight of 524.83 g/mol. Its IUPAC name is 2,4,5-tris(1-adamantyl)-3,6-dimethylphenol.
| Compound Name | 2,4,5-tris(1-adamantyl)-3,6-dimethylphenol |
|---|---|
| PubChem CID | 87124806 |
| Molecular Formula | C38H52O |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.40 |
| IUPAC Name | 2,4,5-tris(1-adamantyl)-3,6-dimethylphenol |
| SMILES | Cc1c(O)c(C23CC4CC(CC(C4)C2)C3)c(C)c(C23CC4CC(CC(C4)C2)C3)c1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C38H52O/c1-21-32(36-12-23-3-24(13-36)5-25(4-23)14-36)33(37-15-26-6-27(16-37)8-28(7-26)17-37)22(2)35(39)34(21)38-18-29-9-30(19-38)11-31(10-29)20-38/h23-31,39H,3-20H2,1-2H3 |
| InChIKey | AYBRTZAXABIOIH-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |