C37H50O — CID 87124838
2,3,6-tris(1-adamantyl)-4-methylphenol (PubChem CID 87124838) has the molecular formula C37H50O and a molecular weight of 510.81 g/mol. Its IUPAC name is 2,3,6-tris(1-adamantyl)-4-methylphenol.
| Compound Name | 2,3,6-tris(1-adamantyl)-4-methylphenol |
|---|---|
| PubChem CID | 87124838 |
| Molecular Formula | C37H50O |
| Molecular Weight | 510.81 g/mol |
| Exact Mass | 510.39 |
| IUPAC Name | 2,3,6-tris(1-adamantyl)-4-methylphenol |
| SMILES | Cc1cc(C23CC4CC(CC(C4)C2)C3)c(O)c(C23CC4CC(CC(C4)C2)C3)c1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C37H50O/c1-21-2-31(35-12-22-3-23(13-35)5-24(4-22)14-35)34(38)33(37-18-28-9-29(19-37)11-30(10-28)20-37)32(21)36-15-25-6-26(16-36)8-27(7-25)17-36/h2,22-30,38H,3-20H2,1H3 |
| InChIKey | MWFYPRHJPVFBMQ-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.81 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |