C47H64O — CID 87124844
2,3,4,6-tetrakis(1-adamantyl)-5-methylphenol (PubChem CID 87124844) has the molecular formula C47H64O and a molecular weight of 645.03 g/mol. Its IUPAC name is 2,3,4,6-tetrakis(1-adamantyl)-5-methylphenol.
| Compound Name | 2,3,4,6-tetrakis(1-adamantyl)-5-methylphenol |
|---|---|
| PubChem CID | 87124844 |
| Molecular Formula | C47H64O |
| Molecular Weight | 645.03 g/mol |
| Exact Mass | 644.50 |
| IUPAC Name | 2,3,4,6-tetrakis(1-adamantyl)-5-methylphenol |
| SMILES | Cc1c(C23CC4CC(CC(C4)C2)C3)c(O)c(C23CC4CC(CC(C4)C2)C3)c(C23CC4CC(CC(C4)C2)C3)c1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C47H64O/c1-26-39(44-14-27-2-28(15-44)4-29(3-27)16-44)41(46-20-33-8-34(21-46)10-35(9-33)22-46)42(47-23-36-11-37(24-47)13-38(12-36)25-47)43(48)40(26)45-17-30-5-31(18-45)7-32(6-30)19-45/h27-38,48H,2-25H2,1H3 |
| InChIKey | KKQCSDKTEYECNJ-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.03 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |