C18H25P — CID 175207614
[6-(1-adamantyl)-2,3-dimethylphenyl]phosphane (PubChem CID 175207614) has the molecular formula C18H25P and a molecular weight of 272.37 g/mol. Its IUPAC name is [6-(1-adamantyl)-2,3-dimethylphenyl]phosphane.
| Compound Name | [6-(1-adamantyl)-2,3-dimethylphenyl]phosphane |
|---|---|
| PubChem CID | 175207614 |
| Molecular Formula | C18H25P |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | [6-(1-adamantyl)-2,3-dimethylphenyl]phosphane |
| SMILES | Cc1ccc(C23CC4CC(CC(C4)C2)C3)c(P)c1C |
| InChI | InChI=1S/C18H25P/c1-11-3-4-16(17(19)12(11)2)18-8-13-5-14(9-18)7-15(6-13)10-18/h3-4,13-15H,5-10,19H2,1-2H3 |
| InChIKey | YRWUSIOFQNEJLI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|