C40H56O — CID 87124943
2,3,4-tris(1-adamantyl)-6-tert-butylphenol (PubChem CID 87124943) has the molecular formula C40H56O and a molecular weight of 552.89 g/mol. Its IUPAC name is 2,3,4-tris(1-adamantyl)-6-tert-butylphenol.
| Compound Name | 2,3,4-tris(1-adamantyl)-6-tert-butylphenol |
|---|---|
| PubChem CID | 87124943 |
| Molecular Formula | C40H56O |
| Molecular Weight | 552.89 g/mol |
| Exact Mass | 552.43 |
| IUPAC Name | 2,3,4-tris(1-adamantyl)-6-tert-butylphenol |
| SMILES | CC(C)(C)c1cc(C23CC4CC(CC(C4)C2)C3)c(C23CC4CC(CC(C4)C2)C3)c(C23CC4CC(CC(C4)C2)C3)c1O |
| InChI | InChI=1S/C40H56O/c1-37(2,3)33-13-32(38-14-23-4-24(15-38)6-25(5-23)16-38)34(39-17-26-7-27(18-39)9-28(8-26)19-39)35(36(33)41)40-20-29-10-30(21-40)12-31(11-29)22-40/h13,23-31,41H,4-12,14-22H2,1-3H3 |
| InChIKey | FKUSKGAMNGUNTN-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.89 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |