C24H37NO — CID 102496107
2-(1-adamantylamino)-4,6-ditert-butylphenol (PubChem CID 102496107) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is 2-(1-adamantylamino)-4,6-ditert-butylphenol.
| Compound Name | 2-(1-adamantylamino)-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 102496107 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | 2-(1-adamantylamino)-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(NC23CC4CC(CC(C4)C2)C3)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H37NO/c1-22(2,3)18-10-19(23(4,5)6)21(26)20(11-18)25-24-12-15-7-16(13-24)9-17(8-15)14-24/h10-11,15-17,25-26H,7-9,12-14H2,1-6H3 |
| InChIKey | ZHDGCLOPMRPQCA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|