C20H33NO — CID 86118767
2,4-ditert-butyl-6-(cyclohexylamino)phenol (PubChem CID 86118767) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(cyclohexylamino)phenol.
| Compound Name | 2,4-ditert-butyl-6-(cyclohexylamino)phenol |
|---|---|
| PubChem CID | 86118767 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 2,4-ditert-butyl-6-(cyclohexylamino)phenol |
| SMILES | CC(C)(C)c1cc(NC2CCCCC2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H33NO/c1-19(2,3)14-12-16(20(4,5)6)18(22)17(13-14)21-15-10-8-7-9-11-15/h12-13,15,21-22H,7-11H2,1-6H3 |
| InChIKey | NHYQWUKNWFIYAV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|