C26H43OP — CID 18541827
2,4-ditert-butyl-6-dicyclohexylphosphanylphenol (PubChem CID 18541827) has the molecular formula C26H43OP and a molecular weight of 402.60 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-dicyclohexylphosphanylphenol.
| Compound Name | 2,4-ditert-butyl-6-dicyclohexylphosphanylphenol |
|---|---|
| PubChem CID | 18541827 |
| Molecular Formula | C26H43OP |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 2,4-ditert-butyl-6-dicyclohexylphosphanylphenol |
| SMILES | CC(C)(C)c1cc(P(C2CCCCC2)C2CCCCC2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H43OP/c1-25(2,3)19-17-22(26(4,5)6)24(27)23(18-19)28(20-13-9-7-10-14-20)21-15-11-8-12-16-21/h17-18,20-21,27H,7-16H2,1-6H3 |
| InChIKey | RWEJXEFYBXWSKY-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|