C26H38N2O2 — CID 4675666
N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]adamantane-1-carboxamide (PubChem CID 4675666) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]adamantane-1-carboxamide.
| Compound Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 4675666 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]adamantane-1-carboxamide |
| SMILES | CC(C)(C)c1cc(C=NNC(=O)C23CC4CC(CC(C4)C2)C3)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H38N2O2/c1-24(2,3)20-10-19(11-21(22(20)29)25(4,5)6)15-27-28-23(30)26-12-16-7-17(13-26)9-18(8-16)14-26/h10-11,15-18,29H,7-9,12-14H2,1-6H3,(H,28,30) |
| InChIKey | AMCOCGRSWDDJAZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|