C21H34N3O2S+ — CID 135852090
N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-thiomorpholin-4-ium-4-ylacetamide (PubChem CID 135852090) has the molecular formula C21H34N3O2S+ and a molecular weight of 392.59 g/mol. Its IUPAC name is N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-thiomorpholin-4-ium-4-ylacetamide.
| Compound Name | N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-thiomorpholin-4-ium-4-ylacetamide |
|---|---|
| PubChem CID | 135852090 |
| Molecular Formula | C21H34N3O2S+ |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-thiomorpholin-4-ium-4-ylacetamide |
| SMILES | CC(C)(C)c1cc(/C=N/NC(=O)C[NH+]2CCSCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H33N3O2S/c1-20(2,3)16-11-15(12-17(19(16)26)21(4,5)6)13-22-23-18(25)14-24-7-9-27-10-8-24/h11-13,26H,7-10,14H2,1-6H3,(H,23,25)/p+1/b22-13+ |
| InChIKey | HMHILKZFWCRYKG-LPYMAVHISA-O |
| XLogP | 2.07 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|