C25H34N2O3 — CID 135479599
N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-(3,4-dimethylphenoxy)acetamide (PubChem CID 135479599) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-(3,4-dimethylphenoxy)acetamide.
| Compound Name | N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-(3,4-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 135479599 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-(3,4-dimethylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)N/N=C/c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1C |
| InChI | InChI=1S/C25H34N2O3/c1-16-9-10-19(11-17(16)2)30-15-22(28)27-26-14-18-12-20(24(3,4)5)23(29)21(13-18)25(6,7)8/h9-14,29H,15H2,1-8H3,(H,27,28)/b26-14+ |
| InChIKey | LWHJYGUOKIDYNF-VULFUBBASA-N |
| XLogP | 5.13 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|