C31H44O — CID 87124942
2,3-bis(1-adamantyl)-6-tert-butyl-4-methylphenol (PubChem CID 87124942) has the molecular formula C31H44O and a molecular weight of 432.69 g/mol. Its IUPAC name is 2,3-bis(1-adamantyl)-6-tert-butyl-4-methylphenol.
| Compound Name | 2,3-bis(1-adamantyl)-6-tert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 87124942 |
| Molecular Formula | C31H44O |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | 2,3-bis(1-adamantyl)-6-tert-butyl-4-methylphenol |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C23CC4CC(CC(C4)C2)C3)c1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C31H44O/c1-18-5-25(29(2,3)4)28(32)27(31-15-22-9-23(16-31)11-24(10-22)17-31)26(18)30-12-19-6-20(13-30)8-21(7-19)14-30/h5,19-24,32H,6-17H2,1-4H3 |
| InChIKey | FKZZEVBRLWOLLC-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |