About Adamantylsilicone
Adamantylsilicone (PubChem CID 18798576) has the molecular formula C10H15Si
and a molecular weight of 163.32 g/mol.
Molecular Properties
| Compound Name | Adamantylsilicone |
| PubChem CID | 18798576 |
| Molecular Formula | C10H15Si |
| Molecular Weight | 163.32 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | — |
| SMILES | [Si]C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H15Si/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2 |
| InChIKey | IXAVTPUKIMXRJE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Adamantylsilicone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Adamantylsilicone?
The IUPAC name of Adamantylsilicone (CID 18798576) is not available.
What is the SMILES notation for Adamantylsilicone?
The canonical SMILES for Adamantylsilicone is [Si]C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of Adamantylsilicone?
The InChIKey is IXAVTPUKIMXRJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15Si/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2.
What are the key properties of Adamantylsilicone?
Adamantylsilicone has a molecular weight of 163.32 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Adamantylsilicone is sourced from PubChem (CID 18798576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).