C24H32 — CID 102260769
1-[4-(1-adamantyl)buta-1,2,3-trienyl]adamantane (PubChem CID 102260769) has the molecular formula C24H32 and a molecular weight of 320.52 g/mol. Its IUPAC name is 1-[4-(1-adamantyl)buta-1,2,3-trienyl]adamantane.
| Compound Name | 1-[4-(1-adamantyl)buta-1,2,3-trienyl]adamantane |
|---|---|
| PubChem CID | 102260769 |
| Molecular Formula | C24H32 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 1-[4-(1-adamantyl)buta-1,2,3-trienyl]adamantane |
| SMILES | C(=C=CC12CC3CC(CC(C3)C1)C2)=CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H32/c1(3-23-11-17-5-18(12-23)7-19(6-17)13-23)2-4-24-14-20-8-21(15-24)10-22(9-20)16-24/h3-4,17-22H,5-16H2/b4-3+ |
| InChIKey | ISRMMXOXSGYZTQ-ONEGZZNKSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |