About CID 15129445
CID 15129445 (PubChem CID 15129445) has the molecular formula C21H31
and a molecular weight of 283.48 g/mol.
Molecular Properties
| Compound Name | CID 15129445 |
| PubChem CID | 15129445 |
| Molecular Formula | C21H31 |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | — |
| SMILES | [CH](C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H31/c1-14-2-16-3-15(1)8-20(7-14,9-16)13-21-10-17-4-18(11-21)6-19(5-17)12-21/h13-19H,1-12H2 |
| InChIKey | CCKDUEYXNCKLRU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 15129445 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15129445?
The IUPAC name of CID 15129445 (CID 15129445) is not available.
What is the SMILES notation for CID 15129445?
The canonical SMILES for CID 15129445 is [CH](C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of CID 15129445?
The InChIKey is CCKDUEYXNCKLRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31/c1-14-2-16-3-15(1)8-20(7-14,9-16)13-21-10-17-4-18(11-21)6-19(5-17)12-21/h13-19H,1-12H2.
What are the key properties of CID 15129445?
CID 15129445 has a molecular weight of 283.48 g/mol, XLogP of 5.62, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15129445 is sourced from PubChem (CID 15129445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).