About 1-adamantylazanium hydroxide
1-adamantylazanium hydroxide (PubChem CID 66728776) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-adamantylazanium hydroxide.
Molecular Properties
| Compound Name | 1-adamantylazanium hydroxide |
| PubChem CID | 66728776 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 1-adamantylazanium hydroxide |
| SMILES | [NH3+]C12CC3CC(CC(C3)C1)C2.[OH-] |
| InChI | InChI=1S/C10H17N.H2O/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;/h7-9H,1-6,11H2;1H2 |
| InChIKey | IDUROJFOPXMBQU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 57.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-adamantylazanium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylazanium hydroxide?
The IUPAC name of 1-adamantylazanium hydroxide (CID 66728776) is 1-adamantylazanium hydroxide.
What is the SMILES notation for 1-adamantylazanium hydroxide?
The canonical SMILES for 1-adamantylazanium hydroxide is [NH3+]C12CC3CC(CC(C3)C1)C2.[OH-].
What is the InChIKey of 1-adamantylazanium hydroxide?
The InChIKey is IDUROJFOPXMBQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.H2O/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;/h7-9H,1-6,11H2;1H2.
What are the key properties of 1-adamantylazanium hydroxide?
1-adamantylazanium hydroxide has a molecular weight of 169.27 g/mol, XLogP of 1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylazanium hydroxide is sourced from PubChem (CID 66728776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).