sodium adamantan-1-olate

C10H15NaO — CID 23673189

IUPACsodium adamantan-1-olate
SMILES[Na+].[O-]C12CC3CC(CC(C3)C1)C2
InChIInChI=1S/C10H15O.Na/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;/h7-9H,1-6H2;/q-1;+1
InChIKeyNHMRUJXVSXNWJZ-UHFFFAOYSA-N
MW174.22 g/mol
LogP-1.68
Rot. Bonds

About sodium adamantan-1-olate

sodium adamantan-1-olate (PubChem CID 23673189) has the molecular formula C10H15NaO and a molecular weight of 174.22 g/mol. Its IUPAC name is sodium adamantan-1-olate.

Molecular Properties

Compound Namesodium adamantan-1-olate
PubChem CID23673189
Molecular FormulaC10H15NaO
Molecular Weight174.22 g/mol
Exact Mass174.10
IUPAC Namesodium adamantan-1-olate
SMILES[Na+].[O-]C12CC3CC(CC(C3)C1)C2
InChIInChI=1S/C10H15O.Na/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;/h7-9H,1-6H2;/q-1;+1
InChIKeyNHMRUJXVSXNWJZ-UHFFFAOYSA-N
XLogP-1.68
TPSA23.06 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.22
LogP ≤ 5-1.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze sodium adamantan-1-olate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium adamantan-1-olate?
The IUPAC name of sodium adamantan-1-olate (CID 23673189) is sodium adamantan-1-olate.
What is the SMILES notation for sodium adamantan-1-olate?
The canonical SMILES for sodium adamantan-1-olate is [Na+].[O-]C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of sodium adamantan-1-olate?
The InChIKey is NHMRUJXVSXNWJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15O.Na/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;/h7-9H,1-6H2;/q-1;+1.
What are the key properties of sodium adamantan-1-olate?
sodium adamantan-1-olate has a molecular weight of 174.22 g/mol, XLogP of -1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium adamantan-1-olate is sourced from PubChem (CID 23673189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).