About 1-adamantylazanium nitrate
1-adamantylazanium nitrate (PubChem CID 165175397) has the molecular formula C10H18N2O3
and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-adamantylazanium nitrate.
Molecular Properties
| Compound Name | 1-adamantylazanium nitrate |
| PubChem CID | 165175397 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 1-adamantylazanium nitrate |
| SMILES | O=[N+]([O-])[O-].[NH3+]C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H17N.NO3/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;2-1(3)4/h7-9H,1-6,11H2;/q;-1/p+1 |
| InChIKey | ZOQSMEOXOFXYAN-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantylazanium nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylazanium nitrate?
The IUPAC name of 1-adamantylazanium nitrate (CID 165175397) is 1-adamantylazanium nitrate.
What is the SMILES notation for 1-adamantylazanium nitrate?
The canonical SMILES for 1-adamantylazanium nitrate is O=[N+]([O-])[O-].[NH3+]C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantylazanium nitrate?
The InChIKey is ZOQSMEOXOFXYAN-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H17N.NO3/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;2-1(3)4/h7-9H,1-6,11H2;/q;-1/p+1.
What are the key properties of 1-adamantylazanium nitrate?
1-adamantylazanium nitrate has a molecular weight of 214.26 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylazanium nitrate is sourced from PubChem (CID 165175397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).